About N-[(8-methoxy-1,2-dihydroacenaphthylen-1-yl)methyl]acetamide
N-[(8-methoxy-1,2-dihydroacenaphthylen-1-yl)methyl]acetamide (PubChem CID 10562968) has the molecular formula C16H17NO2
and a molecular weight of 255.32 g/mol. Its IUPAC name is N-[(8-methoxy-1,2-dihydroacenaphthylen-1-yl)methyl]acetamide.
Molecular Properties
| Compound Name | N-[(8-methoxy-1,2-dihydroacenaphthylen-1-yl)methyl]acetamide |
| PubChem CID | 10562968 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | N-[(8-methoxy-1,2-dihydroacenaphthylen-1-yl)methyl]acetamide |
| SMILES | COc1ccc2cccc3c2c1C(CNC(C)=O)C3 |
| InChI | InChI=1S/C16H17NO2/c1-10(18)17-9-13-8-12-5-3-4-11-6-7-14(19-2)16(13)15(11)12/h3-7,13H,8-9H2,1-2H3,(H,17,18) |
| InChIKey | GVOWMRKLYWGZOG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(8-methoxy-1,2-dihydroacenaphthylen-1-yl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(8-methoxy-1,2-dihydroacenaphthylen-1-yl)methyl]acetamide?
The IUPAC name of N-[(8-methoxy-1,2-dihydroacenaphthylen-1-yl)methyl]acetamide (CID 10562968) is N-[(8-methoxy-1,2-dihydroacenaphthylen-1-yl)methyl]acetamide.
What is the SMILES notation for N-[(8-methoxy-1,2-dihydroacenaphthylen-1-yl)methyl]acetamide?
The canonical SMILES for N-[(8-methoxy-1,2-dihydroacenaphthylen-1-yl)methyl]acetamide is COc1ccc2cccc3c2c1C(CNC(C)=O)C3.
What is the InChIKey of N-[(8-methoxy-1,2-dihydroacenaphthylen-1-yl)methyl]acetamide?
The InChIKey is GVOWMRKLYWGZOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO2/c1-10(18)17-9-13-8-12-5-3-4-11-6-7-14(19-2)16(13)15(11)12/h3-7,13H,8-9H2,1-2H3,(H,17,18).
What are the key properties of N-[(8-methoxy-1,2-dihydroacenaphthylen-1-yl)methyl]acetamide?
N-[(8-methoxy-1,2-dihydroacenaphthylen-1-yl)methyl]acetamide has a molecular weight of 255.32 g/mol, XLogP of 2.62, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(8-methoxy-1,2-dihydroacenaphthylen-1-yl)methyl]acetamide is sourced from PubChem (CID 10562968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).