C15H17NO3 — CID 10563217
6,7-dimethoxy-1-methyl-1,3,4,5-tetrahydrobenzo[e]indol-2-one (PubChem CID 10563217) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is 6,7-dimethoxy-1-methyl-1,3,4,5-tetrahydrobenzo[e]indol-2-one.
| Compound Name | 6,7-dimethoxy-1-methyl-1,3,4,5-tetrahydrobenzo[e]indol-2-one |
|---|---|
| PubChem CID | 10563217 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 6,7-dimethoxy-1-methyl-1,3,4,5-tetrahydrobenzo[e]indol-2-one |
| SMILES | COc1ccc2c(c1OC)CCC1=C2C(C)C(=O)N1 |
| InChI | InChI=1S/C15H17NO3/c1-8-13-9-5-7-12(18-2)14(19-3)10(9)4-6-11(13)16-15(8)17/h5,7-8H,4,6H2,1-3H3,(H,16,17) |
| InChIKey | KXOODBLTQVJOTR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |