About 6,7-dipropyltetrazolo[5,1-f]purin-5-one
6,7-dipropyltetrazolo[5,1-f]purin-5-one (PubChem CID 10563356) has the molecular formula C11H15N7O
and a molecular weight of 261.29 g/mol. Its IUPAC name is 6,7-dipropyltetrazolo[5,1-f]purin-5-one.
Molecular Properties
| Compound Name | 6,7-dipropyltetrazolo[5,1-f]purin-5-one |
| PubChem CID | 10563356 |
| Molecular Formula | C11H15N7O |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 6,7-dipropyltetrazolo[5,1-f]purin-5-one |
| SMILES | CCCn1cnc2c1n(CCC)c(=O)n1nnnc21 |
| InChI | InChI=1S/C11H15N7O/c1-3-5-16-7-12-8-9-13-14-15-18(9)11(19)17(6-4-2)10(8)16/h7H,3-6H2,1-2H3 |
| InChIKey | WKMCTPYODKBXJB-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 6,7-dipropyltetrazolo[5,1-f]purin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dipropyltetrazolo[5,1-f]purin-5-one?
The IUPAC name of 6,7-dipropyltetrazolo[5,1-f]purin-5-one (CID 10563356) is 6,7-dipropyltetrazolo[5,1-f]purin-5-one.
What is the SMILES notation for 6,7-dipropyltetrazolo[5,1-f]purin-5-one?
The canonical SMILES for 6,7-dipropyltetrazolo[5,1-f]purin-5-one is CCCn1cnc2c1n(CCC)c(=O)n1nnnc21.
What is the InChIKey of 6,7-dipropyltetrazolo[5,1-f]purin-5-one?
The InChIKey is WKMCTPYODKBXJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N7O/c1-3-5-16-7-12-8-9-13-14-15-18(9)11(19)17(6-4-2)10(8)16/h7H,3-6H2,1-2H3.
What are the key properties of 6,7-dipropyltetrazolo[5,1-f]purin-5-one?
6,7-dipropyltetrazolo[5,1-f]purin-5-one has a molecular weight of 261.29 g/mol, XLogP of 0.46, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dipropyltetrazolo[5,1-f]purin-5-one is sourced from PubChem (CID 10563356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).