About N-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)acetamide
N-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)acetamide (PubChem CID 10563380) has the molecular formula C16H23NO2
and a molecular weight of 261.37 g/mol. Its IUPAC name is N-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)acetamide.
Molecular Properties
| Compound Name | N-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)acetamide |
| PubChem CID | 10563380 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)acetamide |
| SMILES | CC(=O)Nc1cc(C(C)(C)C)c2c(c1)C(C)(C)CO2 |
| InChI | InChI=1S/C16H23NO2/c1-10(18)17-11-7-12(15(2,3)4)14-13(8-11)16(5,6)9-19-14/h7-8H,9H2,1-6H3,(H,17,18) |
| InChIKey | YCCKDSXKAGIMNB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)acetamide?
The IUPAC name of N-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)acetamide (CID 10563380) is N-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)acetamide.
What is the SMILES notation for N-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)acetamide?
The canonical SMILES for N-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)acetamide is CC(=O)Nc1cc(C(C)(C)C)c2c(c1)C(C)(C)CO2.
What is the InChIKey of N-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)acetamide?
The InChIKey is YCCKDSXKAGIMNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2/c1-10(18)17-11-7-12(15(2,3)4)14-13(8-11)16(5,6)9-19-14/h7-8H,9H2,1-6H3,(H,17,18).
What are the key properties of N-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)acetamide?
N-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)acetamide has a molecular weight of 261.37 g/mol, XLogP of 3.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)acetamide is sourced from PubChem (CID 10563380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).