C16H27N3 — CID 10563387
(2R,7S,9R)-7-pentyl-1,6-diazatricyclo[7.3.0.02,6]dodecane-7-carbonitrile (PubChem CID 10563387) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is (2R,7S,9R)-7-pentyl-1,6-diazatricyclo[7.3.0.02,6]dodecane-7-carbonitrile.
| Compound Name | (2R,7S,9R)-7-pentyl-1,6-diazatricyclo[7.3.0.02,6]dodecane-7-carbonitrile |
|---|---|
| PubChem CID | 10563387 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | (2R,7S,9R)-7-pentyl-1,6-diazatricyclo[7.3.0.02,6]dodecane-7-carbonitrile |
| SMILES | CCCCC[C@@]1(C#N)C[C@H]2CCCN2[C@H]2CCCN21 |
| InChI | InChI=1S/C16H27N3/c1-2-3-4-9-16(13-17)12-14-7-5-10-18(14)15-8-6-11-19(15)16/h14-15H,2-12H2,1H3/t14-,15-,16+/m1/s1 |
| InChIKey | LZQBNQVZUFPBAA-OAGGEKHMSA-N |
| XLogP | 3.12 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|