C15H21NO3 — CID 10563522
methyl (4aS,8aR)-8a-but-3-enyl-4-oxo-5,6,7,8-tetrahydro-4aH-quinoline-1-carboxylate (PubChem CID 10563522) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is methyl (4aS,8aR)-8a-but-3-enyl-4-oxo-5,6,7,8-tetrahydro-4aH-quinoline-1-carboxylate.
| Compound Name | methyl (4aS,8aR)-8a-but-3-enyl-4-oxo-5,6,7,8-tetrahydro-4aH-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 10563522 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | methyl (4aS,8aR)-8a-but-3-enyl-4-oxo-5,6,7,8-tetrahydro-4aH-quinoline-1-carboxylate |
| SMILES | C=CCC[C@]12CCCC[C@@H]1C(=O)C=CN2C(=O)OC |
| InChI | InChI=1S/C15H21NO3/c1-3-4-9-15-10-6-5-7-12(15)13(17)8-11-16(15)14(18)19-2/h3,8,11-12H,1,4-7,9-10H2,2H3/t12-,15+/m1/s1 |
| InChIKey | NGOXZDGYNMXBCJ-DOMZBBRYSA-N |
| XLogP | 3.05 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|