About undec-10-enyl hex-5-enoate
undec-10-enyl hex-5-enoate (PubChem CID 10563721) has the molecular formula C17H30O2
and a molecular weight of 266.42 g/mol. Its IUPAC name is undec-10-enyl hex-5-enoate.
Molecular Properties
| Compound Name | undec-10-enyl hex-5-enoate |
| PubChem CID | 10563721 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | undec-10-enyl hex-5-enoate |
| SMILES | C=CCCCCCCCCCOC(=O)CCCC=C |
| InChI | InChI=1S/C17H30O2/c1-3-5-7-8-9-10-11-12-14-16-19-17(18)15-13-6-4-2/h3-4H,1-2,5-16H2 |
| InChIKey | HKZPYKCBOMDSTR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze undec-10-enyl hex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undec-10-enyl hex-5-enoate?
The IUPAC name of undec-10-enyl hex-5-enoate (CID 10563721) is undec-10-enyl hex-5-enoate.
What is the SMILES notation for undec-10-enyl hex-5-enoate?
The canonical SMILES for undec-10-enyl hex-5-enoate is C=CCCCCCCCCCOC(=O)CCCC=C.
What is the InChIKey of undec-10-enyl hex-5-enoate?
The InChIKey is HKZPYKCBOMDSTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O2/c1-3-5-7-8-9-10-11-12-14-16-19-17(18)15-13-6-4-2/h3-4H,1-2,5-16H2.
What are the key properties of undec-10-enyl hex-5-enoate?
undec-10-enyl hex-5-enoate has a molecular weight of 266.42 g/mol, XLogP of 5.19, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for undec-10-enyl hex-5-enoate is sourced from PubChem (CID 10563721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).