C15H22O4 — CID 10563765
dimethyl 2-[(1S,5R)-1-deuterio-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]propanedioate (PubChem CID 10563765) has the molecular formula C15H22O4 and a molecular weight of 267.34 g/mol. Its IUPAC name is dimethyl 2-[(1S,5R)-1-deuterio-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]propanedioate.
| Compound Name | dimethyl 2-[(1S,5R)-1-deuterio-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]propanedioate |
|---|---|
| PubChem CID | 10563765 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | dimethyl 2-[(1S,5R)-1-deuterio-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]propanedioate |
| SMILES | [2H][C@@]1(C(C(=O)OC)C(=O)OC)C[C@H](C(=C)C)CC=C1C |
| InChI | InChI=1S/C15H22O4/c1-9(2)11-7-6-10(3)12(8-11)13(14(16)18-4)15(17)19-5/h6,11-13H,1,7-8H2,2-5H3/t11-,12-/m1/s1/i12D |
| InChIKey | NFOMXZMDAUJYBH-UGZSFARMSA-N |
| XLogP | 2.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|