C14H22O5 — CID 10563966
(4R,4aS,7R,7aR)-7-methoxy-2,2-dimethyl-4-[(E)-3-methylbut-1-enyl]-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one (PubChem CID 10563966) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is (4R,4aS,7R,7aR)-7-methoxy-2,2-dimethyl-4-[(E)-3-methylbut-1-enyl]-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one.
| Compound Name | (4R,4aS,7R,7aR)-7-methoxy-2,2-dimethyl-4-[(E)-3-methylbut-1-enyl]-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one |
|---|---|
| PubChem CID | 10563966 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (4R,4aS,7R,7aR)-7-methoxy-2,2-dimethyl-4-[(E)-3-methylbut-1-enyl]-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one |
| SMILES | CO[C@H]1C(=O)O[C@@H]2[C@H]1OC(C)(C)O[C@@H]2/C=C/C(C)C |
| InChI | InChI=1S/C14H22O5/c1-8(2)6-7-9-10-11(19-14(3,4)18-9)12(16-5)13(15)17-10/h6-12H,1-5H3/b7-6+/t9-,10+,11-,12-/m1/s1 |
| InChIKey | FRUVEGDVQYOUSM-DLSNBICOSA-N |
| XLogP | 1.66 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|