C16H19NO3 — CID 10564179
methyl (7R,8aS)-5-methyl-7-phenyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate (PubChem CID 10564179) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is methyl (7R,8aS)-5-methyl-7-phenyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate.
| Compound Name | methyl (7R,8aS)-5-methyl-7-phenyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 10564179 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | methyl (7R,8aS)-5-methyl-7-phenyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate |
| SMILES | COC(=O)C1=C(C)N2CCO[C@H]2C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H19NO3/c1-11-15(16(18)19-2)13(12-6-4-3-5-7-12)10-14-17(11)8-9-20-14/h3-7,13-14H,8-10H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | AOCZIBWTJRPJPB-KGLIPLIRSA-N |
| XLogP | 2.28 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |