About 2-cyclohexyl-1,2-benzoselenazol-3-one
2-cyclohexyl-1,2-benzoselenazol-3-one (PubChem CID 10564673) has the molecular formula C13H15NOSe
and a molecular weight of 280.23 g/mol. Its IUPAC name is 2-cyclohexyl-1,2-benzoselenazol-3-one.
Molecular Properties
| Compound Name | 2-cyclohexyl-1,2-benzoselenazol-3-one |
| PubChem CID | 10564673 |
| Molecular Formula | C13H15NOSe |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 2-cyclohexyl-1,2-benzoselenazol-3-one |
| SMILES | O=c1c2ccccc2[se]n1C1CCCCC1 |
| InChI | InChI=1S/C13H15NOSe/c15-13-11-8-4-5-9-12(11)16-14(13)10-6-2-1-3-7-10/h4-5,8-10H,1-3,6-7H2 |
| InChIKey | UVNHHTCMMKAHRA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-1,2-benzoselenazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-1,2-benzoselenazol-3-one?
The IUPAC name of 2-cyclohexyl-1,2-benzoselenazol-3-one (CID 10564673) is 2-cyclohexyl-1,2-benzoselenazol-3-one.
What is the SMILES notation for 2-cyclohexyl-1,2-benzoselenazol-3-one?
The canonical SMILES for 2-cyclohexyl-1,2-benzoselenazol-3-one is O=c1c2ccccc2[se]n1C1CCCCC1.
What is the InChIKey of 2-cyclohexyl-1,2-benzoselenazol-3-one?
The InChIKey is UVNHHTCMMKAHRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NOSe/c15-13-11-8-4-5-9-12(11)16-14(13)10-6-2-1-3-7-10/h4-5,8-10H,1-3,6-7H2.
What are the key properties of 2-cyclohexyl-1,2-benzoselenazol-3-one?
2-cyclohexyl-1,2-benzoselenazol-3-one has a molecular weight of 280.23 g/mol, XLogP of 2.56, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-1,2-benzoselenazol-3-one is sourced from PubChem (CID 10564673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).