About 4-(2-phenylethynyl)-N,N-dipropylcyclohex-3-en-1-amine
4-(2-phenylethynyl)-N,N-dipropylcyclohex-3-en-1-amine (PubChem CID 10564794) has the molecular formula C20H27N
and a molecular weight of 281.44 g/mol. Its IUPAC name is 4-(2-phenylethynyl)-N,N-dipropylcyclohex-3-en-1-amine.
Molecular Properties
| Compound Name | 4-(2-phenylethynyl)-N,N-dipropylcyclohex-3-en-1-amine |
| PubChem CID | 10564794 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 4-(2-phenylethynyl)-N,N-dipropylcyclohex-3-en-1-amine |
| SMILES | CCCN(CCC)C1CC=C(C#Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H27N/c1-3-16-21(17-4-2)20-14-12-19(13-15-20)11-10-18-8-6-5-7-9-18/h5-9,12,20H,3-4,13-17H2,1-2H3 |
| InChIKey | QQFDMLZEFWKHHH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-phenylethynyl)-N,N-dipropylcyclohex-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-phenylethynyl)-N,N-dipropylcyclohex-3-en-1-amine?
The IUPAC name of 4-(2-phenylethynyl)-N,N-dipropylcyclohex-3-en-1-amine (CID 10564794) is 4-(2-phenylethynyl)-N,N-dipropylcyclohex-3-en-1-amine.
What is the SMILES notation for 4-(2-phenylethynyl)-N,N-dipropylcyclohex-3-en-1-amine?
The canonical SMILES for 4-(2-phenylethynyl)-N,N-dipropylcyclohex-3-en-1-amine is CCCN(CCC)C1CC=C(C#Cc2ccccc2)CC1.
What is the InChIKey of 4-(2-phenylethynyl)-N,N-dipropylcyclohex-3-en-1-amine?
The InChIKey is QQFDMLZEFWKHHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N/c1-3-16-21(17-4-2)20-14-12-19(13-15-20)11-10-18-8-6-5-7-9-18/h5-9,12,20H,3-4,13-17H2,1-2H3.
What are the key properties of 4-(2-phenylethynyl)-N,N-dipropylcyclohex-3-en-1-amine?
4-(2-phenylethynyl)-N,N-dipropylcyclohex-3-en-1-amine has a molecular weight of 281.44 g/mol, XLogP of 4.64, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-phenylethynyl)-N,N-dipropylcyclohex-3-en-1-amine is sourced from PubChem (CID 10564794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).