About methyl 5-acetyl-2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate
methyl 5-acetyl-2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate (PubChem CID 10564841) has the molecular formula C11H10N2O3S2
and a molecular weight of 282.35 g/mol. Its IUPAC name is methyl 5-acetyl-2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 5-acetyl-2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate |
| PubChem CID | 10564841 |
| Molecular Formula | C11H10N2O3S2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | methyl 5-acetyl-2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1nc(-c2csc(C)n2)sc1C(C)=O |
| InChI | InChI=1S/C11H10N2O3S2/c1-5(14)9-8(11(15)16-3)13-10(18-9)7-4-17-6(2)12-7/h4H,1-3H3 |
| InChIKey | VVRJWUVIDQHGRW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 5-acetyl-2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-acetyl-2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate?
The IUPAC name of methyl 5-acetyl-2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate (CID 10564841) is methyl 5-acetyl-2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for methyl 5-acetyl-2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate?
The canonical SMILES for methyl 5-acetyl-2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate is COC(=O)c1nc(-c2csc(C)n2)sc1C(C)=O.
What is the InChIKey of methyl 5-acetyl-2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate?
The InChIKey is VVRJWUVIDQHGRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O3S2/c1-5(14)9-8(11(15)16-3)13-10(18-9)7-4-17-6(2)12-7/h4H,1-3H3.
What are the key properties of methyl 5-acetyl-2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate?
methyl 5-acetyl-2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate has a molecular weight of 282.35 g/mol, XLogP of 2.56, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-acetyl-2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 10564841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).