About 3-[(3,5-dimethyl-4-methylsulfanylphenoxy)carbonylamino]propanoic acid
3-[(3,5-dimethyl-4-methylsulfanylphenoxy)carbonylamino]propanoic acid (PubChem CID 10564923) has the molecular formula C13H17NO4S
and a molecular weight of 283.35 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-4-methylsulfanylphenoxy)carbonylamino]propanoic acid.
Molecular Properties
| Compound Name | 3-[(3,5-dimethyl-4-methylsulfanylphenoxy)carbonylamino]propanoic acid |
| PubChem CID | 10564923 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 3-[(3,5-dimethyl-4-methylsulfanylphenoxy)carbonylamino]propanoic acid |
| SMILES | CSc1c(C)cc(OC(=O)NCCC(=O)O)cc1C |
| InChI | InChI=1S/C13H17NO4S/c1-8-6-10(7-9(2)12(8)19-3)18-13(17)14-5-4-11(15)16/h6-7H,4-5H2,1-3H3,(H,14,17)(H,15,16) |
| InChIKey | IVVMUAIYUQYOFR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(3,5-dimethyl-4-methylsulfanylphenoxy)carbonylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,5-dimethyl-4-methylsulfanylphenoxy)carbonylamino]propanoic acid?
The IUPAC name of 3-[(3,5-dimethyl-4-methylsulfanylphenoxy)carbonylamino]propanoic acid (CID 10564923) is 3-[(3,5-dimethyl-4-methylsulfanylphenoxy)carbonylamino]propanoic acid.
What is the SMILES notation for 3-[(3,5-dimethyl-4-methylsulfanylphenoxy)carbonylamino]propanoic acid?
The canonical SMILES for 3-[(3,5-dimethyl-4-methylsulfanylphenoxy)carbonylamino]propanoic acid is CSc1c(C)cc(OC(=O)NCCC(=O)O)cc1C.
What is the InChIKey of 3-[(3,5-dimethyl-4-methylsulfanylphenoxy)carbonylamino]propanoic acid?
The InChIKey is IVVMUAIYUQYOFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO4S/c1-8-6-10(7-9(2)12(8)19-3)18-13(17)14-5-4-11(15)16/h6-7H,4-5H2,1-3H3,(H,14,17)(H,15,16).
What are the key properties of 3-[(3,5-dimethyl-4-methylsulfanylphenoxy)carbonylamino]propanoic acid?
3-[(3,5-dimethyl-4-methylsulfanylphenoxy)carbonylamino]propanoic acid has a molecular weight of 283.35 g/mol, XLogP of 2.59, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-dimethyl-4-methylsulfanylphenoxy)carbonylamino]propanoic acid is sourced from PubChem (CID 10564923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).