C19H25NO — CID 10564935
(1R,3E,5R,6R)-3-benzylidene-6-butyl-8-methyl-8-azabicyclo[3.2.1]octan-2-one (PubChem CID 10564935) has the molecular formula C19H25NO and a molecular weight of 283.41 g/mol. Its IUPAC name is (1R,3E,5R,6R)-3-benzylidene-6-butyl-8-methyl-8-azabicyclo[3.2.1]octan-2-one.
| Compound Name | (1R,3E,5R,6R)-3-benzylidene-6-butyl-8-methyl-8-azabicyclo[3.2.1]octan-2-one |
|---|---|
| PubChem CID | 10564935 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | (1R,3E,5R,6R)-3-benzylidene-6-butyl-8-methyl-8-azabicyclo[3.2.1]octan-2-one |
| SMILES | CCCC[C@@H]1C[C@@H]2C(=O)/C(=C/c3ccccc3)C[C@H]1N2C |
| InChI | InChI=1S/C19H25NO/c1-3-4-10-15-12-18-19(21)16(13-17(15)20(18)2)11-14-8-6-5-7-9-14/h5-9,11,15,17-18H,3-4,10,12-13H2,1-2H3/b16-11+/t15-,17-,18-/m1/s1 |
| InChIKey | DRNXKOAIXIQNAK-DJDPAZEASA-N |
| XLogP | 3.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|