About cobalt(2+) carbonate
cobalt(2+) carbonate (PubChem CID 10565) has the molecular formula CCoO3
and a molecular weight of 118.94 g/mol. Its IUPAC name is cobalt(2+) carbonate.
Molecular Properties
| Compound Name | cobalt(2+) carbonate |
| PubChem CID | 10565 |
| Molecular Formula | CCoO3 |
| Molecular Weight | 118.94 g/mol |
| Exact Mass | 118.92 |
| IUPAC Name | cobalt(2+) carbonate |
| SMILES | O=C([O-])[O-].[Co+2] |
| InChI | InChI=1S/CH2O3.Co/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 |
| InChIKey | ZOTKGJBKKKVBJZ-UHFFFAOYSA-L |
| XLogP | -2.45 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.94 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cobalt(2+) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+) carbonate?
The IUPAC name of cobalt(2+) carbonate (CID 10565) is cobalt(2+) carbonate.
What is the SMILES notation for cobalt(2+) carbonate?
The canonical SMILES for cobalt(2+) carbonate is O=C([O-])[O-].[Co+2].
What is the InChIKey of cobalt(2+) carbonate?
The InChIKey is ZOTKGJBKKKVBJZ-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.Co/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2.
What are the key properties of cobalt(2+) carbonate?
cobalt(2+) carbonate has a molecular weight of 118.94 g/mol, XLogP of -2.45, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+) carbonate is sourced from PubChem (CID 10565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).