C16H12ClNO2 — CID 10565095
(1R,2S,11S,12S)-7-chloro-10-oxo-3-oxatetracyclo[10.2.2.02,11.04,9]hexadeca-4(9),5,7,13-tetraene-11-carbonitrile (PubChem CID 10565095) has the molecular formula C16H12ClNO2 and a molecular weight of 285.73 g/mol. Its IUPAC name is (1R,2S,11S,12S)-7-chloro-10-oxo-3-oxatetracyclo[10.2.2.02,11.04,9]hexadeca-4(9),5,7,13-tetraene-11-carbonitrile.
| Compound Name | (1R,2S,11S,12S)-7-chloro-10-oxo-3-oxatetracyclo[10.2.2.02,11.04,9]hexadeca-4(9),5,7,13-tetraene-11-carbonitrile |
|---|---|
| PubChem CID | 10565095 |
| Molecular Formula | C16H12ClNO2 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | (1R,2S,11S,12S)-7-chloro-10-oxo-3-oxatetracyclo[10.2.2.02,11.04,9]hexadeca-4(9),5,7,13-tetraene-11-carbonitrile |
| SMILES | N#C[C@]12C(=O)c3cc(Cl)ccc3O[C@H]1[C@H]1C=C[C@@H]2CC1 |
| InChI | InChI=1S/C16H12ClNO2/c17-11-5-6-13-12(7-11)14(19)16(8-18)10-3-1-9(2-4-10)15(16)20-13/h1,3,5-7,9-10,15H,2,4H2/t9-,10+,15-,16-/m0/s1 |
| InChIKey | PESXBTHJNZPHOE-UIHHKEIPSA-N |
| XLogP | 3.39 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|