C14H24O6 — CID 10565279
(4R,5R,6R)-4-[(2R,4S,5S,6S)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-5-ethyl-6-methyloxan-2-one (PubChem CID 10565279) has the molecular formula C14H24O6 and a molecular weight of 288.34 g/mol. Its IUPAC name is (4R,5R,6R)-4-[(2R,4S,5S,6S)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-5-ethyl-6-methyloxan-2-one.
| Compound Name | (4R,5R,6R)-4-[(2R,4S,5S,6S)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-5-ethyl-6-methyloxan-2-one |
|---|---|
| PubChem CID | 10565279 |
| Molecular Formula | C14H24O6 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (4R,5R,6R)-4-[(2R,4S,5S,6S)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-5-ethyl-6-methyloxan-2-one |
| SMILES | CC[C@@H]1[C@@H](C)OC(=O)C[C@H]1O[C@H]1C[C@H](O)[C@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C14H24O6/c1-4-9-7(2)18-12(16)6-11(9)20-13-5-10(15)14(17)8(3)19-13/h7-11,13-15,17H,4-6H2,1-3H3/t7-,8+,9-,10+,11-,13+,14-/m1/s1 |
| InChIKey | CMXATUILVILQQE-UGMPATFPSA-N |
| XLogP | 0.59 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |