About 2-chloroethyl (2E)-2-(2,1,3-benzoxadiazol-4-ylmethylidene)-3-oxobutanoate
2-chloroethyl (2E)-2-(2,1,3-benzoxadiazol-4-ylmethylidene)-3-oxobutanoate (PubChem CID 10565770) has the molecular formula C13H11ClN2O4
and a molecular weight of 294.69 g/mol. Its IUPAC name is 2-chloroethyl (2E)-2-(2,1,3-benzoxadiazol-4-ylmethylidene)-3-oxobutanoate.
Molecular Properties
| Compound Name | 2-chloroethyl (2E)-2-(2,1,3-benzoxadiazol-4-ylmethylidene)-3-oxobutanoate |
| PubChem CID | 10565770 |
| Molecular Formula | C13H11ClN2O4 |
| Molecular Weight | 294.69 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 2-chloroethyl (2E)-2-(2,1,3-benzoxadiazol-4-ylmethylidene)-3-oxobutanoate |
| SMILES | CC(=O)/C(=C\c1cccc2nonc12)C(=O)OCCCl |
| InChI | InChI=1S/C13H11ClN2O4/c1-8(17)10(13(18)19-6-5-14)7-9-3-2-4-11-12(9)16-20-15-11/h2-4,7H,5-6H2,1H3/b10-7+ |
| InChIKey | PNSJIVFEUJAJBZ-JXMROGBWSA-N |
| XLogP | 1.98 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.69 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroethyl (2E)-2-(2,1,3-benzoxadiazol-4-ylmethylidene)-3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroethyl (2E)-2-(2,1,3-benzoxadiazol-4-ylmethylidene)-3-oxobutanoate?
The IUPAC name of 2-chloroethyl (2E)-2-(2,1,3-benzoxadiazol-4-ylmethylidene)-3-oxobutanoate (CID 10565770) is 2-chloroethyl (2E)-2-(2,1,3-benzoxadiazol-4-ylmethylidene)-3-oxobutanoate.
What is the SMILES notation for 2-chloroethyl (2E)-2-(2,1,3-benzoxadiazol-4-ylmethylidene)-3-oxobutanoate?
The canonical SMILES for 2-chloroethyl (2E)-2-(2,1,3-benzoxadiazol-4-ylmethylidene)-3-oxobutanoate is CC(=O)/C(=C\c1cccc2nonc12)C(=O)OCCCl.
What is the InChIKey of 2-chloroethyl (2E)-2-(2,1,3-benzoxadiazol-4-ylmethylidene)-3-oxobutanoate?
The InChIKey is PNSJIVFEUJAJBZ-JXMROGBWSA-N. The full InChI is InChI=1S/C13H11ClN2O4/c1-8(17)10(13(18)19-6-5-14)7-9-3-2-4-11-12(9)16-20-15-11/h2-4,7H,5-6H2,1H3/b10-7+.
What are the key properties of 2-chloroethyl (2E)-2-(2,1,3-benzoxadiazol-4-ylmethylidene)-3-oxobutanoate?
2-chloroethyl (2E)-2-(2,1,3-benzoxadiazol-4-ylmethylidene)-3-oxobutanoate has a molecular weight of 294.69 g/mol, XLogP of 1.98, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroethyl (2E)-2-(2,1,3-benzoxadiazol-4-ylmethylidene)-3-oxobutanoate is sourced from PubChem (CID 10565770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).