C18H21NO3 — CID 10566061
4,10,10-trimethyl-11-oxa-3-azatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,7(12),13,15-pentaene-2,6-diol (PubChem CID 10566061) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 4,10,10-trimethyl-11-oxa-3-azatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,7(12),13,15-pentaene-2,6-diol.
| Compound Name | 4,10,10-trimethyl-11-oxa-3-azatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,7(12),13,15-pentaene-2,6-diol |
|---|---|
| PubChem CID | 10566061 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 4,10,10-trimethyl-11-oxa-3-azatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,7(12),13,15-pentaene-2,6-diol |
| SMILES | CC1=NC2(O)c3ccccc3C3=C(CCC(C)(C)O3)C2(O)C1 |
| InChI | InChI=1S/C18H21NO3/c1-11-10-17(20)14-8-9-16(2,3)22-15(14)12-6-4-5-7-13(12)18(17,21)19-11/h4-7,20-21H,8-10H2,1-3H3 |
| InChIKey | NMMASRLIEKYEPJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |