C17H34O4 — CID 10566302
[(3R,4S,5R,6R,7R)-5,7-dihydroxy-2,4,6,8-tetramethylnonan-3-yl] 2-methylpropanoate (PubChem CID 10566302) has the molecular formula C17H34O4 and a molecular weight of 302.46 g/mol. Its IUPAC name is [(3R,4S,5R,6R,7R)-5,7-dihydroxy-2,4,6,8-tetramethylnonan-3-yl] 2-methylpropanoate.
| Compound Name | [(3R,4S,5R,6R,7R)-5,7-dihydroxy-2,4,6,8-tetramethylnonan-3-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 10566302 |
| Molecular Formula | C17H34O4 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | [(3R,4S,5R,6R,7R)-5,7-dihydroxy-2,4,6,8-tetramethylnonan-3-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@H](C(C)C)[C@@H](C)[C@H](O)[C@H](C)[C@H](O)C(C)C |
| InChI | InChI=1S/C17H34O4/c1-9(2)14(18)12(7)15(19)13(8)16(10(3)4)21-17(20)11(5)6/h9-16,18-19H,1-8H3/t12-,13+,14-,15-,16-/m1/s1 |
| InChIKey | QSVHGWMEZPGRLQ-YIDVYQOGSA-N |
| XLogP | 2.86 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |