About ethyl (E)-3-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]prop-2-enoate
ethyl (E)-3-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]prop-2-enoate (PubChem CID 10566406) has the molecular formula C16H16O6
and a molecular weight of 304.30 g/mol. Its IUPAC name is ethyl (E)-3-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]prop-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-3-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]prop-2-enoate |
| PubChem CID | 10566406 |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | ethyl (E)-3-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/C1=CC(=O)C(/C=C/C(=O)OCC)=CC1=O |
| InChI | InChI=1S/C16H16O6/c1-3-21-15(19)7-5-11-9-14(18)12(10-13(11)17)6-8-16(20)22-4-2/h5-10H,3-4H2,1-2H3/b7-5+,8-6+ |
| InChIKey | UOORMTYTPWYDOC-KQQUZDAGSA-N |
| XLogP | 1.23 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-3-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-3-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]prop-2-enoate?
The IUPAC name of ethyl (E)-3-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]prop-2-enoate (CID 10566406) is ethyl (E)-3-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]prop-2-enoate.
What is the SMILES notation for ethyl (E)-3-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]prop-2-enoate?
The canonical SMILES for ethyl (E)-3-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]prop-2-enoate is CCOC(=O)/C=C/C1=CC(=O)C(/C=C/C(=O)OCC)=CC1=O.
What is the InChIKey of ethyl (E)-3-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]prop-2-enoate?
The InChIKey is UOORMTYTPWYDOC-KQQUZDAGSA-N. The full InChI is InChI=1S/C16H16O6/c1-3-21-15(19)7-5-11-9-14(18)12(10-13(11)17)6-8-16(20)22-4-2/h5-10H,3-4H2,1-2H3/b7-5+,8-6+.
What are the key properties of ethyl (E)-3-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]prop-2-enoate?
ethyl (E)-3-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]prop-2-enoate has a molecular weight of 304.30 g/mol, XLogP of 1.23, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-3-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]prop-2-enoate is sourced from PubChem (CID 10566406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).