About (2S)-2-(4,5-dimethoxy-2-trimethylsilylphenyl)-2-(hydroxymethyl)cyclobutan-1-one
(2S)-2-(4,5-dimethoxy-2-trimethylsilylphenyl)-2-(hydroxymethyl)cyclobutan-1-one (PubChem CID 10566779) has the molecular formula C16H24O4Si
and a molecular weight of 308.45 g/mol. Its IUPAC name is (2S)-2-(4,5-dimethoxy-2-trimethylsilylphenyl)-2-(hydroxymethyl)cyclobutan-1-one.
Molecular Properties
| Compound Name | (2S)-2-(4,5-dimethoxy-2-trimethylsilylphenyl)-2-(hydroxymethyl)cyclobutan-1-one |
| PubChem CID | 10566779 |
| Molecular Formula | C16H24O4Si |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (2S)-2-(4,5-dimethoxy-2-trimethylsilylphenyl)-2-(hydroxymethyl)cyclobutan-1-one |
| SMILES | COc1cc([C@]2(CO)CCC2=O)c([Si](C)(C)C)cc1OC |
| InChI | InChI=1S/C16H24O4Si/c1-19-12-8-11(16(10-17)7-6-15(16)18)14(21(3,4)5)9-13(12)20-2/h8-9,17H,6-7,10H2,1-5H3/t16-/m1/s1 |
| InChIKey | JDPSETDFQXUCAV-MRXNPFEDSA-N |
| XLogP | 1.84 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-(4,5-dimethoxy-2-trimethylsilylphenyl)-2-(hydroxymethyl)cyclobutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(4,5-dimethoxy-2-trimethylsilylphenyl)-2-(hydroxymethyl)cyclobutan-1-one?
The IUPAC name of (2S)-2-(4,5-dimethoxy-2-trimethylsilylphenyl)-2-(hydroxymethyl)cyclobutan-1-one (CID 10566779) is (2S)-2-(4,5-dimethoxy-2-trimethylsilylphenyl)-2-(hydroxymethyl)cyclobutan-1-one.
What is the SMILES notation for (2S)-2-(4,5-dimethoxy-2-trimethylsilylphenyl)-2-(hydroxymethyl)cyclobutan-1-one?
The canonical SMILES for (2S)-2-(4,5-dimethoxy-2-trimethylsilylphenyl)-2-(hydroxymethyl)cyclobutan-1-one is COc1cc([C@]2(CO)CCC2=O)c([Si](C)(C)C)cc1OC.
What is the InChIKey of (2S)-2-(4,5-dimethoxy-2-trimethylsilylphenyl)-2-(hydroxymethyl)cyclobutan-1-one?
The InChIKey is JDPSETDFQXUCAV-MRXNPFEDSA-N. The full InChI is InChI=1S/C16H24O4Si/c1-19-12-8-11(16(10-17)7-6-15(16)18)14(21(3,4)5)9-13(12)20-2/h8-9,17H,6-7,10H2,1-5H3/t16-/m1/s1.
What are the key properties of (2S)-2-(4,5-dimethoxy-2-trimethylsilylphenyl)-2-(hydroxymethyl)cyclobutan-1-one?
(2S)-2-(4,5-dimethoxy-2-trimethylsilylphenyl)-2-(hydroxymethyl)cyclobutan-1-one has a molecular weight of 308.45 g/mol, XLogP of 1.84, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(4,5-dimethoxy-2-trimethylsilylphenyl)-2-(hydroxymethyl)cyclobutan-1-one is sourced from PubChem (CID 10566779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).