C20H24FNO — CID 10567186
2-[2-(4-fluorophenyl)ethyl]-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine (PubChem CID 10567186) has the molecular formula C20H24FNO and a molecular weight of 313.42 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)ethyl]-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine.
| Compound Name | 2-[2-(4-fluorophenyl)ethyl]-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 10567186 |
| Molecular Formula | C20H24FNO |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 2-[2-(4-fluorophenyl)ethyl]-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine |
| SMILES | Cc1c(C)c2c(c(C)c1N)CC(C)(CCc1ccc(F)cc1)O2 |
| InChI | InChI=1S/C20H24FNO/c1-12-13(2)19-17(14(3)18(12)22)11-20(4,23-19)10-9-15-5-7-16(21)8-6-15/h5-8H,9-11,22H2,1-4H3 |
| InChIKey | MHYNVJVRWPXSMU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|