About 3-(3'-ethoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)phenol
3-(3'-ethoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)phenol (PubChem CID 10567417) has the molecular formula C19H24O4
and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-(3'-ethoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)phenol.
Molecular Properties
| Compound Name | 3-(3'-ethoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)phenol |
| PubChem CID | 10567417 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 3-(3'-ethoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)phenol |
| SMILES | CCOC1(c2cccc(O)c2)OOC12C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C19H24O4/c1-2-21-19(14-4-3-5-17(20)11-14)18(22-23-19)15-7-12-6-13(9-15)10-16(18)8-12/h3-5,11-13,15-16,20H,2,6-10H2,1H3 |
| InChIKey | YQMBDGLBAGWWDT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3'-ethoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3'-ethoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)phenol?
The IUPAC name of 3-(3'-ethoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)phenol (CID 10567417) is 3-(3'-ethoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)phenol.
What is the SMILES notation for 3-(3'-ethoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)phenol?
The canonical SMILES for 3-(3'-ethoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)phenol is CCOC1(c2cccc(O)c2)OOC12C1CC3CC(C1)CC2C3.
What is the InChIKey of 3-(3'-ethoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)phenol?
The InChIKey is YQMBDGLBAGWWDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O4/c1-2-21-19(14-4-3-5-17(20)11-14)18(22-23-19)15-7-12-6-13(9-15)10-16(18)8-12/h3-5,11-13,15-16,20H,2,6-10H2,1H3.
What are the key properties of 3-(3'-ethoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)phenol?
3-(3'-ethoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)phenol has a molecular weight of 316.40 g/mol, XLogP of 3.74, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3'-ethoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)phenol is sourced from PubChem (CID 10567417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).