C20H31NO2 — CID 10567511
3-[(1S,4aR,4bS,7S,8aR,10aR)-7-(methoxymethoxy)-2-methylidene-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthren-1-yl]propanenitrile (PubChem CID 10567511) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is 3-[(1S,4aR,4bS,7S,8aR,10aR)-7-(methoxymethoxy)-2-methylidene-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthren-1-yl]propanenitrile.
| Compound Name | 3-[(1S,4aR,4bS,7S,8aR,10aR)-7-(methoxymethoxy)-2-methylidene-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthren-1-yl]propanenitrile |
|---|---|
| PubChem CID | 10567511 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 3-[(1S,4aR,4bS,7S,8aR,10aR)-7-(methoxymethoxy)-2-methylidene-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthren-1-yl]propanenitrile |
| SMILES | C=C1CC[C@H]2[C@@H](CC[C@@H]3C[C@@H](OCOC)CC[C@@H]32)[C@@H]1CCC#N |
| InChI | InChI=1S/C20H31NO2/c1-14-5-8-20-18-10-7-16(23-13-22-2)12-15(18)6-9-19(20)17(14)4-3-11-21/h15-20H,1,3-10,12-13H2,2H3/t15-,16+,17-,18+,19+,20-/m1/s1 |
| InChIKey | DCIGRKIJVDXYGI-XHYRXIGBSA-N |
| XLogP | 4.69 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|