C16H16O7 — CID 10567685
dimethyl (1R,4S,6R,9S)-11,14,15-trioxapentacyclo[7.3.1.11,4.16,9.05,13]pentadeca-2,7-diene-5,13-dicarboxylate (PubChem CID 10567685) has the molecular formula C16H16O7 and a molecular weight of 320.30 g/mol. Its IUPAC name is dimethyl (1R,4S,6R,9S)-11,14,15-trioxapentacyclo[7.3.1.11,4.16,9.05,13]pentadeca-2,7-diene-5,13-dicarboxylate.
| Compound Name | dimethyl (1R,4S,6R,9S)-11,14,15-trioxapentacyclo[7.3.1.11,4.16,9.05,13]pentadeca-2,7-diene-5,13-dicarboxylate |
|---|---|
| PubChem CID | 10567685 |
| Molecular Formula | C16H16O7 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | dimethyl (1R,4S,6R,9S)-11,14,15-trioxapentacyclo[7.3.1.11,4.16,9.05,13]pentadeca-2,7-diene-5,13-dicarboxylate |
| SMILES | COC(=O)C12[C@@H]3C=C[C@@]4(COC[C@]5(C=C[C@H]1O5)C24C(=O)OC)O3 |
| InChI | InChI=1S/C16H16O7/c1-19-11(17)15-9-3-5-13(22-9)7-21-8-14(6-4-10(15)23-14)16(13,15)12(18)20-2/h3-6,9-10H,7-8H2,1-2H3/t9-,10+,13-,14+,15?,16? |
| InChIKey | VZRYPLGZARUOIB-CUFQIHMISA-N |
| XLogP | -0.25 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|