C17H26O6 — CID 10568136
(4'aS)-4'a-(2-methoxyethoxymethoxymethyl)spiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydro-3H-naphthalene]-2'-one (PubChem CID 10568136) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is (4'aS)-4'a-(2-methoxyethoxymethoxymethyl)spiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydro-3H-naphthalene]-2'-one.
| Compound Name | (4'aS)-4'a-(2-methoxyethoxymethoxymethyl)spiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydro-3H-naphthalene]-2'-one |
|---|---|
| PubChem CID | 10568136 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | (4'aS)-4'a-(2-methoxyethoxymethoxymethyl)spiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydro-3H-naphthalene]-2'-one |
| SMILES | COCCOCOC[C@]12CCC(=O)C=C1CCCC21OCCO1 |
| InChI | InChI=1S/C17H26O6/c1-19-7-8-20-13-21-12-16-6-4-15(18)11-14(16)3-2-5-17(16)22-9-10-23-17/h11H,2-10,12-13H2,1H3/t16-/m1/s1 |
| InChIKey | AXFVQIHSBYABIA-MRXNPFEDSA-N |
| XLogP | 1.83 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|