About CID 10568327
CID 10568327 (PubChem CID 10568327) has the molecular formula C11H14NO3
and a molecular weight of 208.24 g/mol.
Molecular Properties
| Compound Name | CID 10568327 |
| PubChem CID | 10568327 |
| Molecular Formula | C11H14NO3 |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | — |
| SMILES | COC(=O)[C@@H]1C[C@@H]([C]2[CH][CH][CH][CH]2)N(C)O1 |
| InChI | InChI=1S/C11H14NO3/c1-12-9(8-5-3-4-6-8)7-10(15-12)11(13)14-2/h3-6,9-10H,7H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | KEFHXPMCYXOBPW-UWVGGRQHSA-N |
| XLogP | 0.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 10568327 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10568327?
The IUPAC name of CID 10568327 (CID 10568327) is not available.
What is the SMILES notation for CID 10568327?
The canonical SMILES for CID 10568327 is COC(=O)[C@@H]1C[C@@H]([C]2[CH][CH][CH][CH]2)N(C)O1.
What is the InChIKey of CID 10568327?
The InChIKey is KEFHXPMCYXOBPW-UWVGGRQHSA-N. The full InChI is InChI=1S/C11H14NO3/c1-12-9(8-5-3-4-6-8)7-10(15-12)11(13)14-2/h3-6,9-10H,7H2,1-2H3/t9-,10-/m0/s1.
What are the key properties of CID 10568327?
CID 10568327 has a molecular weight of 208.24 g/mol, XLogP of 0.57, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10568327 is sourced from PubChem (CID 10568327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).