C20H30O2Si — CID 10568454
(1S,9S)-6-triethylsilyloxytricyclo[7.4.1.01,5]tetradeca-5,10,12-trien-14-one (PubChem CID 10568454) has the molecular formula C20H30O2Si and a molecular weight of 330.54 g/mol. Its IUPAC name is (1S,9S)-6-triethylsilyloxytricyclo[7.4.1.01,5]tetradeca-5,10,12-trien-14-one.
| Compound Name | (1S,9S)-6-triethylsilyloxytricyclo[7.4.1.01,5]tetradeca-5,10,12-trien-14-one |
|---|---|
| PubChem CID | 10568454 |
| Molecular Formula | C20H30O2Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | (1S,9S)-6-triethylsilyloxytricyclo[7.4.1.01,5]tetradeca-5,10,12-trien-14-one |
| SMILES | CC[Si](CC)(CC)OC1=C2CCC[C@]23C=CC=C[C@H](CC1)C3=O |
| InChI | InChI=1S/C20H30O2Si/c1-4-23(5-2,6-3)22-18-13-12-16-10-7-8-14-20(19(16)21)15-9-11-17(18)20/h7-8,10,14,16H,4-6,9,11-13,15H2,1-3H3/t16-,20-/m1/s1 |
| InChIKey | SGMQYQGNSJHTSD-OXQOHEQNSA-N |
| XLogP | 5.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|