C21H33NS — CID 10568519
(1R,4S,4aS,8aS)-4-isothiocyanato-4,7-dimethyl-1-[(2R)-6-methylhept-5-en-2-yl]-2,3,4a,5,6,8a-hexahydro-1H-naphthalene (PubChem CID 10568519) has the molecular formula C21H33NS and a molecular weight of 331.57 g/mol. Its IUPAC name is (1R,4S,4aS,8aS)-4-isothiocyanato-4,7-dimethyl-1-[(2R)-6-methylhept-5-en-2-yl]-2,3,4a,5,6,8a-hexahydro-1H-naphthalene.
| Compound Name | (1R,4S,4aS,8aS)-4-isothiocyanato-4,7-dimethyl-1-[(2R)-6-methylhept-5-en-2-yl]-2,3,4a,5,6,8a-hexahydro-1H-naphthalene |
|---|---|
| PubChem CID | 10568519 |
| Molecular Formula | C21H33NS |
| Molecular Weight | 331.57 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | (1R,4S,4aS,8aS)-4-isothiocyanato-4,7-dimethyl-1-[(2R)-6-methylhept-5-en-2-yl]-2,3,4a,5,6,8a-hexahydro-1H-naphthalene |
| SMILES | CC(C)=CCC[C@@H](C)[C@H]1CC[C@](C)(N=C=S)[C@H]2CCC(C)=C[C@H]12 |
| InChI | InChI=1S/C21H33NS/c1-15(2)7-6-8-17(4)18-11-12-21(5,22-14-23)20-10-9-16(3)13-19(18)20/h7,13,17-20H,6,8-12H2,1-5H3/t17-,18-,19-,20+,21+/m1/s1 |
| InChIKey | VCGAHYOORHXESQ-XKRYSZRTSA-N |
| XLogP | 6.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.57 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|