C20H28O4 — CID 10568580
(1S,2E,6S,8S,9R,11E)-9-hydroxy-3,8,12,16-tetramethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-trien-17-one (PubChem CID 10568580) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (1S,2E,6S,8S,9R,11E)-9-hydroxy-3,8,12,16-tetramethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-trien-17-one.
| Compound Name | (1S,2E,6S,8S,9R,11E)-9-hydroxy-3,8,12,16-tetramethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-trien-17-one |
|---|---|
| PubChem CID | 10568580 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (1S,2E,6S,8S,9R,11E)-9-hydroxy-3,8,12,16-tetramethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-trien-17-one |
| SMILES | CC1=C2CC/C(C)=C/C[C@@H](O)[C@]3(C)O[C@H]3CC/C(C)=C/[C@@H]2OC1=O |
| InChI | InChI=1S/C20H28O4/c1-12-5-8-15-14(3)19(22)23-16(15)11-13(2)7-10-18-20(4,24-18)17(21)9-6-12/h6,11,16-18,21H,5,7-10H2,1-4H3/b12-6+,13-11+/t16-,17+,18-,20-/m0/s1 |
| InChIKey | PLXYTNVUDOBBTD-HLIUTOOASA-N |
| XLogP | 3.60 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|