C13H22O8S — CID 10569008
[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl methanesulfonate (PubChem CID 10569008) has the molecular formula C13H22O8S and a molecular weight of 338.38 g/mol. Its IUPAC name is [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl methanesulfonate.
| Compound Name | [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 10569008 |
| Molecular Formula | C13H22O8S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl methanesulfonate |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[C@@]3(COS(C)(=O)=O)OC(C)(C)O[C@@H]23)O1 |
| InChI | InChI=1S/C13H22O8S/c1-11(2)18-8-6-16-13(7-17-22(5,14)15)10(9(8)19-11)20-12(3,4)21-13/h8-10H,6-7H2,1-5H3/t8-,9-,10+,13+/m1/s1 |
| InChIKey | GYYDSWVRSOBLIU-DNJQJEMRSA-N |
| XLogP | 0.36 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|