About N-[benzotriazol-1-yl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-methylaniline
N-[benzotriazol-1-yl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-methylaniline (PubChem CID 10569015) has the molecular formula C19H22N4O2
and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[benzotriazol-1-yl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-methylaniline.
Molecular Properties
| Compound Name | N-[benzotriazol-1-yl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-methylaniline |
| PubChem CID | 10569015 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | N-[benzotriazol-1-yl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-methylaniline |
| SMILES | Cc1cccc(NC([C@H]2COC(C)(C)O2)n2nnc3ccccc32)c1 |
| InChI | InChI=1S/C19H22N4O2/c1-13-7-6-8-14(11-13)20-18(17-12-24-19(2,3)25-17)23-16-10-5-4-9-15(16)21-22-23/h4-11,17-18,20H,12H2,1-3H3/t17-,18?/m1/s1 |
| InChIKey | YSTIJHCPZJGQLB-QNSVNVJESA-N |
| XLogP | 3.50 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[benzotriazol-1-yl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[benzotriazol-1-yl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-methylaniline?
The IUPAC name of N-[benzotriazol-1-yl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-methylaniline (CID 10569015) is N-[benzotriazol-1-yl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-methylaniline.
What is the SMILES notation for N-[benzotriazol-1-yl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-methylaniline?
The canonical SMILES for N-[benzotriazol-1-yl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-methylaniline is Cc1cccc(NC([C@H]2COC(C)(C)O2)n2nnc3ccccc32)c1.
What is the InChIKey of N-[benzotriazol-1-yl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-methylaniline?
The InChIKey is YSTIJHCPZJGQLB-QNSVNVJESA-N. The full InChI is InChI=1S/C19H22N4O2/c1-13-7-6-8-14(11-13)20-18(17-12-24-19(2,3)25-17)23-16-10-5-4-9-15(16)21-22-23/h4-11,17-18,20H,12H2,1-3H3/t17-,18?/m1/s1.
What are the key properties of N-[benzotriazol-1-yl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-methylaniline?
N-[benzotriazol-1-yl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-methylaniline has a molecular weight of 338.41 g/mol, XLogP of 3.50, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[benzotriazol-1-yl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-methylaniline is sourced from PubChem (CID 10569015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).