C16H25NO3SSi — CID 10569108
5-ethyl-1-(4-methylphenyl)sulfonyl-3-trimethylsilylpyrrolidin-2-one (PubChem CID 10569108) has the molecular formula C16H25NO3SSi and a molecular weight of 339.53 g/mol. Its IUPAC name is 5-ethyl-1-(4-methylphenyl)sulfonyl-3-trimethylsilylpyrrolidin-2-one.
| Compound Name | 5-ethyl-1-(4-methylphenyl)sulfonyl-3-trimethylsilylpyrrolidin-2-one |
|---|---|
| PubChem CID | 10569108 |
| Molecular Formula | C16H25NO3SSi |
| Molecular Weight | 339.53 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 5-ethyl-1-(4-methylphenyl)sulfonyl-3-trimethylsilylpyrrolidin-2-one |
| SMILES | CCC1CC([Si](C)(C)C)C(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H25NO3SSi/c1-6-13-11-15(22(3,4)5)16(18)17(13)21(19,20)14-9-7-12(2)8-10-14/h7-10,13,15H,6,11H2,1-5H3 |
| InChIKey | DGUNZCNOQGISHU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|