C18H34O4Si — CID 10569346
tert-butyl-[2-[(2S,3R)-3-[(Z)-5-(1,3-dioxolan-2-yl)pent-2-enyl]oxiran-2-yl]ethoxy]-dimethylsilane (PubChem CID 10569346) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is tert-butyl-[2-[(2S,3R)-3-[(Z)-5-(1,3-dioxolan-2-yl)pent-2-enyl]oxiran-2-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(2S,3R)-3-[(Z)-5-(1,3-dioxolan-2-yl)pent-2-enyl]oxiran-2-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10569346 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | tert-butyl-[2-[(2S,3R)-3-[(Z)-5-(1,3-dioxolan-2-yl)pent-2-enyl]oxiran-2-yl]ethoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H]1O[C@@H]1C/C=C\CCC1OCCO1 |
| InChI | InChI=1S/C18H34O4Si/c1-18(2,3)23(4,5)21-12-11-16-15(22-16)9-7-6-8-10-17-19-13-14-20-17/h6-7,15-17H,8-14H2,1-5H3/b7-6-/t15-,16+/m1/s1 |
| InChIKey | XQRVNVVUBCVOBH-UWUBPMADSA-N |
| XLogP | 4.27 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|