C17H20F3NO3 — CID 10569373
ethyl (2S)-2-[4-[bis(prop-2-enyl)amino]phenyl]-3,3,3-trifluoro-2-hydroxypropanoate (PubChem CID 10569373) has the molecular formula C17H20F3NO3 and a molecular weight of 343.35 g/mol. Its IUPAC name is ethyl (2S)-2-[4-[bis(prop-2-enyl)amino]phenyl]-3,3,3-trifluoro-2-hydroxypropanoate.
| Compound Name | ethyl (2S)-2-[4-[bis(prop-2-enyl)amino]phenyl]-3,3,3-trifluoro-2-hydroxypropanoate |
|---|---|
| PubChem CID | 10569373 |
| Molecular Formula | C17H20F3NO3 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | ethyl (2S)-2-[4-[bis(prop-2-enyl)amino]phenyl]-3,3,3-trifluoro-2-hydroxypropanoate |
| SMILES | C=CCN(CC=C)c1ccc([C@](O)(C(=O)OCC)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H20F3NO3/c1-4-11-21(12-5-2)14-9-7-13(8-10-14)16(23,17(18,19)20)15(22)24-6-3/h4-5,7-10,23H,1-2,6,11-12H2,3H3/t16-/m0/s1 |
| InChIKey | PKYDNNDESAVVGF-INIZCTEOSA-N |
| XLogP | 3.18 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|