C16H24O6S — CID 10569466
ethyl (2S)-2-hydroxy-7-methylsulfonyloxy-2-phenylheptanoate (PubChem CID 10569466) has the molecular formula C16H24O6S and a molecular weight of 344.43 g/mol. Its IUPAC name is ethyl (2S)-2-hydroxy-7-methylsulfonyloxy-2-phenylheptanoate.
| Compound Name | ethyl (2S)-2-hydroxy-7-methylsulfonyloxy-2-phenylheptanoate |
|---|---|
| PubChem CID | 10569466 |
| Molecular Formula | C16H24O6S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | ethyl (2S)-2-hydroxy-7-methylsulfonyloxy-2-phenylheptanoate |
| SMILES | CCOC(=O)[C@](O)(CCCCCOS(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C16H24O6S/c1-3-21-15(17)16(18,14-10-6-4-7-11-14)12-8-5-9-13-22-23(2,19)20/h4,6-7,10-11,18H,3,5,8-9,12-13H2,1-2H3/t16-/m0/s1 |
| InChIKey | SNMOCCDPBIAQJR-INIZCTEOSA-N |
| XLogP | 1.97 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|