C24H42O — CID 10569636
(5Z,8Z,11Z,14Z)-1-butan-2-yloxyicosa-5,8,11,14-tetraene (PubChem CID 10569636) has the molecular formula C24H42O and a molecular weight of 346.60 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-1-butan-2-yloxyicosa-5,8,11,14-tetraene.
| Compound Name | (5Z,8Z,11Z,14Z)-1-butan-2-yloxyicosa-5,8,11,14-tetraene |
|---|---|
| PubChem CID | 10569636 |
| Molecular Formula | C24H42O |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.32 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-1-butan-2-yloxyicosa-5,8,11,14-tetraene |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCOC(C)CC |
| InChI | InChI=1S/C24H42O/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-25-24(3)5-2/h9-10,12-13,15-16,18-19,24H,4-8,11,14,17,20-23H2,1-3H3/b10-9-,13-12-,16-15-,19-18- |
| InChIKey | ZRUKAIKMHYCHDJ-SNPVRQPZSA-N |
| XLogP | 7.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|