C16H21BF4OS — CID 10569706
(1S,5R,7R)-10,10-dimethyl-3-phenyl-4-oxa-3-thioniatricyclo[5.2.1.01,5]decane tetrafluoroborate (PubChem CID 10569706) has the molecular formula C16H21BF4OS and a molecular weight of 348.21 g/mol. Its IUPAC name is (1S,5R,7R)-10,10-dimethyl-3-phenyl-4-oxa-3-thioniatricyclo[5.2.1.01,5]decane tetrafluoroborate.
| Compound Name | (1S,5R,7R)-10,10-dimethyl-3-phenyl-4-oxa-3-thioniatricyclo[5.2.1.01,5]decane tetrafluoroborate |
|---|---|
| PubChem CID | 10569706 |
| Molecular Formula | C16H21BF4OS |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (1S,5R,7R)-10,10-dimethyl-3-phenyl-4-oxa-3-thioniatricyclo[5.2.1.01,5]decane tetrafluoroborate |
| SMILES | CC1(C)[C@@H]2CC[C@]13C[S+](c1ccccc1)O[C@@H]3C2.F[B-](F)(F)F |
| InChI | InChI=1S/C16H21OS.BF4/c1-15(2)12-8-9-16(15)11-18(17-14(16)10-12)13-6-4-3-5-7-13;2-1(3,4)5/h3-7,12,14H,8-11H2,1-2H3;/q+1;-1/t12-,14-,16-,18?;/m1./s1 |
| InChIKey | GKWSZUABCHPCFL-JRSMDZIBSA-N |
| XLogP | 5.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|