About 4-cyanobenzenediazonium
4-cyanobenzenediazonium (PubChem CID 10569720) has the molecular formula C7H4N3+
and a molecular weight of 130.13 g/mol. Its IUPAC name is 4-cyanobenzenediazonium.
Molecular Properties
| Compound Name | 4-cyanobenzenediazonium |
| PubChem CID | 10569720 |
| Molecular Formula | C7H4N3+ |
| Molecular Weight | 130.13 g/mol |
| Exact Mass | 130.04 |
| IUPAC Name | 4-cyanobenzenediazonium |
| SMILES | N#Cc1ccc([N+]#N)cc1 |
| InChI | InChI=1S/C7H4N3/c8-5-6-1-3-7(10-9)4-2-6/h1-4H/q+1 |
| InChIKey | XYFCGHOOAKDJGQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 51.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.13 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-cyanobenzenediazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyanobenzenediazonium?
The IUPAC name of 4-cyanobenzenediazonium (CID 10569720) is 4-cyanobenzenediazonium.
What is the SMILES notation for 4-cyanobenzenediazonium?
The canonical SMILES for 4-cyanobenzenediazonium is N#Cc1ccc([N+]#N)cc1.
What is the InChIKey of 4-cyanobenzenediazonium?
The InChIKey is XYFCGHOOAKDJGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N3/c8-5-6-1-3-7(10-9)4-2-6/h1-4H/q+1.
What are the key properties of 4-cyanobenzenediazonium?
4-cyanobenzenediazonium has a molecular weight of 130.13 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyanobenzenediazonium is sourced from PubChem (CID 10569720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).