C20H28O5 — CID 10569746
[4-[[(1S,6R,8R,9R,12S)-12-methoxy-9-methyl-10,11,13-trioxatricyclo[7.2.2.01,6]tridecan-8-yl]methyl]phenyl]methanol (PubChem CID 10569746) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is [4-[[(1S,6R,8R,9R,12S)-12-methoxy-9-methyl-10,11,13-trioxatricyclo[7.2.2.01,6]tridecan-8-yl]methyl]phenyl]methanol.
| Compound Name | [4-[[(1S,6R,8R,9R,12S)-12-methoxy-9-methyl-10,11,13-trioxatricyclo[7.2.2.01,6]tridecan-8-yl]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 10569746 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | [4-[[(1S,6R,8R,9R,12S)-12-methoxy-9-methyl-10,11,13-trioxatricyclo[7.2.2.01,6]tridecan-8-yl]methyl]phenyl]methanol |
| SMILES | CO[C@H]1O[C@]2(C)OO[C@]13CCCC[C@@H]3C[C@@H]2Cc1ccc(CO)cc1 |
| InChI | InChI=1S/C20H28O5/c1-19-17(11-14-6-8-15(13-21)9-7-14)12-16-5-3-4-10-20(16,25-24-19)18(22-2)23-19/h6-9,16-18,21H,3-5,10-13H2,1-2H3/t16-,17+,18+,19-,20+/m1/s1 |
| InChIKey | BTZOVXWKSBJWMK-CXQPBAHBSA-N |
| XLogP | 3.34 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|