C22H27NO3 — CID 10570072
(1S,2S,6S,10R,12R,14S)-5-[(benzylamino)methyl]-14-methyl-9-methylidene-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradecan-4-one (PubChem CID 10570072) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is (1S,2S,6S,10R,12R,14S)-5-[(benzylamino)methyl]-14-methyl-9-methylidene-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradecan-4-one.
| Compound Name | (1S,2S,6S,10R,12R,14S)-5-[(benzylamino)methyl]-14-methyl-9-methylidene-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradecan-4-one |
|---|---|
| PubChem CID | 10570072 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (1S,2S,6S,10R,12R,14S)-5-[(benzylamino)methyl]-14-methyl-9-methylidene-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradecan-4-one |
| SMILES | C=C1CC[C@H]2C(CNCc3ccccc3)C(=O)O[C@@H]2[C@@H]2[C@H]1C[C@H]1O[C@@]21C |
| InChI | InChI=1S/C22H27NO3/c1-13-8-9-15-17(12-23-11-14-6-4-3-5-7-14)21(24)25-20(15)19-16(13)10-18-22(19,2)26-18/h3-7,15-20,23H,1,8-12H2,2H3/t15-,16-,17?,18+,19-,20-,22+/m0/s1 |
| InChIKey | JIMCXDMFYCGMDW-WNGFKORZSA-N |
| XLogP | 3.08 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|