About 3-(3,5-dimethoxyphenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide
3-(3,5-dimethoxyphenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 10570106) has the molecular formula C19H18N2O5
and a molecular weight of 354.36 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide.
Molecular Properties
| Compound Name | 3-(3,5-dimethoxyphenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide |
| PubChem CID | 10570106 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | COc1cc(OC)cc(C(CC(N)=O)N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C19H18N2O5/c1-25-12-7-11(8-13(9-12)26-2)16(10-17(20)22)21-18(23)14-5-3-4-6-15(14)19(21)24/h3-9,16H,10H2,1-2H3,(H2,20,22) |
| InChIKey | KPCSISQFPQWXTP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-dimethoxyphenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethoxyphenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide?
The IUPAC name of 3-(3,5-dimethoxyphenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide (CID 10570106) is 3-(3,5-dimethoxyphenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide.
What is the SMILES notation for 3-(3,5-dimethoxyphenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide?
The canonical SMILES for 3-(3,5-dimethoxyphenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide is COc1cc(OC)cc(C(CC(N)=O)N2C(=O)c3ccccc3C2=O)c1.
What is the InChIKey of 3-(3,5-dimethoxyphenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide?
The InChIKey is KPCSISQFPQWXTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O5/c1-25-12-7-11(8-13(9-12)26-2)16(10-17(20)22)21-18(23)14-5-3-4-6-15(14)19(21)24/h3-9,16H,10H2,1-2H3,(H2,20,22).
What are the key properties of 3-(3,5-dimethoxyphenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide?
3-(3,5-dimethoxyphenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide has a molecular weight of 354.36 g/mol, XLogP of 1.92, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethoxyphenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide is sourced from PubChem (CID 10570106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).