About 2-(benzenesulfonyl)-6-(4-butylphenyl)-4,5-dihydro-3H-pyridazine
2-(benzenesulfonyl)-6-(4-butylphenyl)-4,5-dihydro-3H-pyridazine (PubChem CID 10570269) has the molecular formula C20H24N2O2S
and a molecular weight of 356.49 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-6-(4-butylphenyl)-4,5-dihydro-3H-pyridazine.
Molecular Properties
| Compound Name | 2-(benzenesulfonyl)-6-(4-butylphenyl)-4,5-dihydro-3H-pyridazine |
| PubChem CID | 10570269 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 2-(benzenesulfonyl)-6-(4-butylphenyl)-4,5-dihydro-3H-pyridazine |
| SMILES | CCCCc1ccc(C2=NN(S(=O)(=O)c3ccccc3)CCC2)cc1 |
| InChI | InChI=1S/C20H24N2O2S/c1-2-3-8-17-12-14-18(15-13-17)20-11-7-16-22(21-20)25(23,24)19-9-5-4-6-10-19/h4-6,9-10,12-15H,2-3,7-8,11,16H2,1H3 |
| InChIKey | XJYTYUUOVHXTNL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(benzenesulfonyl)-6-(4-butylphenyl)-4,5-dihydro-3H-pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonyl)-6-(4-butylphenyl)-4,5-dihydro-3H-pyridazine?
The IUPAC name of 2-(benzenesulfonyl)-6-(4-butylphenyl)-4,5-dihydro-3H-pyridazine (CID 10570269) is 2-(benzenesulfonyl)-6-(4-butylphenyl)-4,5-dihydro-3H-pyridazine.
What is the SMILES notation for 2-(benzenesulfonyl)-6-(4-butylphenyl)-4,5-dihydro-3H-pyridazine?
The canonical SMILES for 2-(benzenesulfonyl)-6-(4-butylphenyl)-4,5-dihydro-3H-pyridazine is CCCCc1ccc(C2=NN(S(=O)(=O)c3ccccc3)CCC2)cc1.
What is the InChIKey of 2-(benzenesulfonyl)-6-(4-butylphenyl)-4,5-dihydro-3H-pyridazine?
The InChIKey is XJYTYUUOVHXTNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O2S/c1-2-3-8-17-12-14-18(15-13-17)20-11-7-16-22(21-20)25(23,24)19-9-5-4-6-10-19/h4-6,9-10,12-15H,2-3,7-8,11,16H2,1H3.
What are the key properties of 2-(benzenesulfonyl)-6-(4-butylphenyl)-4,5-dihydro-3H-pyridazine?
2-(benzenesulfonyl)-6-(4-butylphenyl)-4,5-dihydro-3H-pyridazine has a molecular weight of 356.49 g/mol, XLogP of 4.22, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonyl)-6-(4-butylphenyl)-4,5-dihydro-3H-pyridazine is sourced from PubChem (CID 10570269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).