C10H10F12 — CID 10570347
1,1,1,2,3,3,7,7,8,9,9,9-dodecafluoro-4-methylnonane (PubChem CID 10570347) has the molecular formula C10H10F12 and a molecular weight of 358.17 g/mol. Its IUPAC name is 1,1,1,2,3,3,7,7,8,9,9,9-dodecafluoro-4-methylnonane.
| Compound Name | 1,1,1,2,3,3,7,7,8,9,9,9-dodecafluoro-4-methylnonane |
|---|---|
| PubChem CID | 10570347 |
| Molecular Formula | C10H10F12 |
| Molecular Weight | 358.17 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 1,1,1,2,3,3,7,7,8,9,9,9-dodecafluoro-4-methylnonane |
| SMILES | CC(CCC(F)(F)C(F)C(F)(F)F)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C10H10F12/c1-4(8(15,16)6(12)10(20,21)22)2-3-7(13,14)5(11)9(17,18)19/h4-6H,2-3H2,1H3 |
| InChIKey | SSEIJTRVRYKJRR-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.17 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |