About 2-pyridin-2-yl-5-[4-(6-pyridin-2-yl-3-pyridinyl)buta-1,3-diynyl]pyridine
2-pyridin-2-yl-5-[4-(6-pyridin-2-yl-3-pyridinyl)buta-1,3-diynyl]pyridine (PubChem CID 10570370) has the molecular formula C24H14N4
and a molecular weight of 358.40 g/mol. Its IUPAC name is 2-pyridin-2-yl-5-[4-(6-pyridin-2-yl-3-pyridinyl)buta-1,3-diynyl]pyridine.
Molecular Properties
| Compound Name | 2-pyridin-2-yl-5-[4-(6-pyridin-2-yl-3-pyridinyl)buta-1,3-diynyl]pyridine |
| PubChem CID | 10570370 |
| Molecular Formula | C24H14N4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 2-pyridin-2-yl-5-[4-(6-pyridin-2-yl-3-pyridinyl)buta-1,3-diynyl]pyridine |
| SMILES | C(C#Cc1ccc(-c2ccccn2)nc1)#Cc1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C24H14N4/c1(7-19-11-13-23(27-17-19)21-9-3-5-15-25-21)2-8-20-12-14-24(28-18-20)22-10-4-6-16-26-22/h3-6,9-18H |
| InChIKey | YGJXNFQUDXCDDQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-pyridin-2-yl-5-[4-(6-pyridin-2-yl-3-pyridinyl)buta-1,3-diynyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-yl-5-[4-(6-pyridin-2-yl-3-pyridinyl)buta-1,3-diynyl]pyridine?
The IUPAC name of 2-pyridin-2-yl-5-[4-(6-pyridin-2-yl-3-pyridinyl)buta-1,3-diynyl]pyridine (CID 10570370) is 2-pyridin-2-yl-5-[4-(6-pyridin-2-yl-3-pyridinyl)buta-1,3-diynyl]pyridine.
What is the SMILES notation for 2-pyridin-2-yl-5-[4-(6-pyridin-2-yl-3-pyridinyl)buta-1,3-diynyl]pyridine?
The canonical SMILES for 2-pyridin-2-yl-5-[4-(6-pyridin-2-yl-3-pyridinyl)buta-1,3-diynyl]pyridine is C(C#Cc1ccc(-c2ccccn2)nc1)#Cc1ccc(-c2ccccn2)nc1.
What is the InChIKey of 2-pyridin-2-yl-5-[4-(6-pyridin-2-yl-3-pyridinyl)buta-1,3-diynyl]pyridine?
The InChIKey is YGJXNFQUDXCDDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H14N4/c1(7-19-11-13-23(27-17-19)21-9-3-5-15-25-21)2-8-20-12-14-24(28-18-20)22-10-4-6-16-26-22/h3-6,9-18H.
What are the key properties of 2-pyridin-2-yl-5-[4-(6-pyridin-2-yl-3-pyridinyl)buta-1,3-diynyl]pyridine?
2-pyridin-2-yl-5-[4-(6-pyridin-2-yl-3-pyridinyl)buta-1,3-diynyl]pyridine has a molecular weight of 358.40 g/mol, XLogP of 4.00, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-yl-5-[4-(6-pyridin-2-yl-3-pyridinyl)buta-1,3-diynyl]pyridine is sourced from PubChem (CID 10570370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).