C21H27ClN2O — CID 10570422
8-chloro-3-[4-(methylamino)butyl]-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol (PubChem CID 10570422) has the molecular formula C21H27ClN2O and a molecular weight of 358.91 g/mol. Its IUPAC name is 8-chloro-3-[4-(methylamino)butyl]-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol.
| Compound Name | 8-chloro-3-[4-(methylamino)butyl]-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol |
|---|---|
| PubChem CID | 10570422 |
| Molecular Formula | C21H27ClN2O |
| Molecular Weight | 358.91 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 8-chloro-3-[4-(methylamino)butyl]-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol |
| SMILES | CNCCCCN1CCc2cc(Cl)c(O)cc2C(c2ccccc2)C1 |
| InChI | InChI=1S/C21H27ClN2O/c1-23-10-5-6-11-24-12-9-17-13-20(22)21(25)14-18(17)19(15-24)16-7-3-2-4-8-16/h2-4,7-8,13-14,19,23,25H,5-6,9-12,15H2,1H3 |
| InChIKey | JQYPCXSMFIVWTI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.91 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|