About 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methylpyridine
5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methylpyridine (PubChem CID 10570444) has the molecular formula C19H15F2NO2S
and a molecular weight of 359.40 g/mol. Its IUPAC name is 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methylpyridine.
Molecular Properties
| Compound Name | 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methylpyridine |
| PubChem CID | 10570444 |
| Molecular Formula | C19H15F2NO2S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methylpyridine |
| SMILES | Cc1ccc(-c2cc(F)c(F)cc2-c2ccc(S(C)(=O)=O)cc2)cn1 |
| InChI | InChI=1S/C19H15F2NO2S/c1-12-3-4-14(11-22-12)17-10-19(21)18(20)9-16(17)13-5-7-15(8-6-13)25(2,23)24/h3-11H,1-2H3 |
| InChIKey | MKFHCOCWLKUAMC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methylpyridine?
The IUPAC name of 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methylpyridine (CID 10570444) is 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methylpyridine.
What is the SMILES notation for 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methylpyridine?
The canonical SMILES for 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methylpyridine is Cc1ccc(-c2cc(F)c(F)cc2-c2ccc(S(C)(=O)=O)cc2)cn1.
What is the InChIKey of 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methylpyridine?
The InChIKey is MKFHCOCWLKUAMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15F2NO2S/c1-12-3-4-14(11-22-12)17-10-19(21)18(20)9-16(17)13-5-7-15(8-6-13)25(2,23)24/h3-11H,1-2H3.
What are the key properties of 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methylpyridine?
5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methylpyridine has a molecular weight of 359.40 g/mol, XLogP of 4.41, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methylpyridine is sourced from PubChem (CID 10570444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).