C18H33NO6 — CID 10570462
1-O-tert-butyl 3-O-methyl (3S,4R,6R)-4-hydroxy-6-(6-hydroxyhexyl)piperidine-1,3-dicarboxylate (PubChem CID 10570462) has the molecular formula C18H33NO6 and a molecular weight of 359.46 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl (3S,4R,6R)-4-hydroxy-6-(6-hydroxyhexyl)piperidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl (3S,4R,6R)-4-hydroxy-6-(6-hydroxyhexyl)piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 10570462 |
| Molecular Formula | C18H33NO6 |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl (3S,4R,6R)-4-hydroxy-6-(6-hydroxyhexyl)piperidine-1,3-dicarboxylate |
| SMILES | COC(=O)[C@H]1CN(C(=O)OC(C)(C)C)[C@H](CCCCCCO)C[C@H]1O |
| InChI | InChI=1S/C18H33NO6/c1-18(2,3)25-17(23)19-12-14(16(22)24-4)15(21)11-13(19)9-7-5-6-8-10-20/h13-15,20-21H,5-12H2,1-4H3/t13-,14+,15-/m1/s1 |
| InChIKey | WYVZMPXIGGUQGS-QLFBSQMISA-N |
| XLogP | 2.09 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|